EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N6 |
| Net Charge | 0 |
| Average Mass | 246.318 |
| Monoisotopic Mass | 246.15929 |
| SMILES | CC(C)c1nc2nc(N)nc(N)c2nc1C(C)C |
| InChI | InChI=1S/C12H18N6/c1-5(2)7-8(6(3)4)16-11-9(15-7)10(13)17-12(14)18-11/h5-6H,1-4H3,(H4,13,14,16,17,18) |
| InChIKey | LIVXWXAMTVJGCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | vibriostatic agent Any compound that inhibits the growth of bacteria of the genus Vibrio. antifolate An antimetabolite that impairs the action of folic acids |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-diamino-6,7-diisopropylpteridine (CHEBI:73908) has role antifolate (CHEBI:73913) |
| 2,4-diamino-6,7-diisopropylpteridine (CHEBI:73908) has role vibriostatic agent (CHEBI:73911) |
| 2,4-diamino-6,7-diisopropylpteridine (CHEBI:73908) is a primary amino compound (CHEBI:50994) |
| 2,4-diamino-6,7-diisopropylpteridine (CHEBI:73908) is a pteridines (CHEBI:26373) |
| IUPAC Name |
|---|
| 6,7-diisopropylpteridine-2,4-diamine |
| Synonyms | Source |
|---|---|
| 0/129 | ChEBI |
| AH10639 | ChEBI |
| O 129 | ChEBI |
| O/129 | ChEBI |
| O129 | ChEBI |
| vibriostat | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:268787 | Reaxys |
| Citations |
|---|