EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O3 |
| Net Charge | 0 |
| Average Mass | 188.227 |
| Monoisotopic Mass | 188.11609 |
| SMILES | CC[C@H](C)[C@H](NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C8H16N2O3/c1-3-5(2)7(8(12)13)10-6(11)4-9/h5,7H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t5-,7-/m0/s1 |
| InChIKey | KGVHCTWYMPWEGN-FSPLSTOPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Ile (CHEBI:73907) has role metabolite (CHEBI:25212) |
| Gly-Ile (CHEBI:73907) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| glycyl-L-isoleucine |
| Synonyms | Source |
|---|---|
| N-glycyl-L-isoleucine | ChemIDplus |
| GI | ChEBI |
| glycylisoleucine | ChEBI |
| Glycyl-Isoleucine | HMDB |
| Gly-L-Ile | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028844 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726353 | Reaxys |
| CAS:19461-38-2 | ChemIDplus |