EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O4 |
| Net Charge | 0 |
| Average Mass | 458.683 |
| Monoisotopic Mass | 458.33961 |
| SMILES | [H][C@]1([C@]([H])(C)CCCC(C)C)CC[C@@]2([H])/C(=C/C=C3/C[C@@H](O)C[C@H](O)C3=C)CCC[C@]12COC(C)=O |
| InChI | InChI=1S/C29H46O4/c1-19(2)8-6-9-20(3)26-13-14-27-23(10-7-15-29(26,27)18-33-22(5)30)11-12-24-16-25(31)17-28(32)21(24)4/h11-12,19-20,25-28,31-32H,4,6-10,13-18H2,1-3,5H3/b23-11+,24-12-/t20-,25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | PXVFRWYXTUOPCC-JORAJEIRSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-acetoxy-1α-hydroxyvitamin D3 (CHEBI:73906) has role metabolite (CHEBI:25212) |
| 18-acetoxy-1α-hydroxyvitamin D3 (CHEBI:73906) is a D3 vitamins (CHEBI:73558) |
| 18-acetoxy-1α-hydroxyvitamin D3 (CHEBI:73906) is a diol (CHEBI:23824) |
| 18-acetoxy-1α-hydroxyvitamin D3 (CHEBI:73906) is a hydroxycalciol (CHEBI:47042) |
| IUPAC Name |
|---|
| (1S,3R,5Z,7E)-1,3-dihydroxy-9,10-secocholesta-5,7,10-trien-18-yl acetate |
| Synonyms | Source |
|---|---|
| 18-acetoxy-1α-hydroxycholecalciferol | LIPID MAPS |
| (5Z,7E)-(1S,3R)-18-acetoxy-9,10-seco-5,7,10(19)-cholestatriene-1,3-diol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST03020409 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5835222 | Reaxys |