EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N3O4 |
| Net Charge | 0 |
| Average Mass | 245.279 |
| Monoisotopic Mass | 245.13756 |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)CN)C(=O)O |
| InChI | InChI=1S/C10H19N3O4/c1-6(2)3-7(10(16)17)13-9(15)5-12-8(14)4-11/h6-7H,3-5,11H2,1-2H3,(H,12,14)(H,13,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | XPJBQTCXPJNIFE-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Gly-Leu (CHEBI:73904) has role metabolite (CHEBI:25212) |
| Gly-Gly-Leu (CHEBI:73904) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| glycylglycyl-L-leucine |
| Synonyms | Source |
|---|---|
| GGL | ChEBI |
| glycylglycylleucine | ChEBI |
| Gly-Gly-L-Leu | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729173 | Reaxys |