EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37NO3 |
| Net Charge | 0 |
| Average Mass | 315.498 |
| Monoisotopic Mass | 315.27734 |
| SMILES | CCCCCCCCCCCCC(O)/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-16(21)13-14-18(22)17(19)15-20/h13-14,16-18,20-22H,2-12,15,19H2,1H3/b14-13+/t16?,17-,18+/m0/s1 |
| InChIKey | LUZYTSCABOWJAC-HLJNGVMWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxysphing-4E-enine (CHEBI:73900) has functional parent sphingosine (CHEBI:16393) |
| 6-hydroxysphing-4E-enine (CHEBI:73900) has role metabolite (CHEBI:25212) |
| 6-hydroxysphing-4E-enine (CHEBI:73900) is a amino alcohol (CHEBI:22478) |
| 6-hydroxysphing-4E-enine (CHEBI:73900) is a sphingoid (CHEBI:35785) |
| 6-hydroxysphing-4E-enine (CHEBI:73900) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (2S,3R,4E)-2-aminooctadec-4-ene-1,3,6-triol |
| Manual Xrefs | Databases |
|---|---|
| LMSP01080003 | LIPID MAPS |