EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13N3O4 |
| Net Charge | 0 |
| Average Mass | 203.198 |
| Monoisotopic Mass | 203.09061 |
| SMILES | C[C@H](NC(=O)CNC(=O)CN)C(=O)O |
| InChI | InChI=1S/C7H13N3O4/c1-4(7(13)14)10-6(12)3-9-5(11)2-8/h4H,2-3,8H2,1H3,(H,9,11)(H,10,12)(H,13,14)/t4-/m0/s1 |
| InChIKey | CCQOOWAONKGYKQ-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Gly-Ala (CHEBI:73899) has role metabolite (CHEBI:25212) |
| Gly-Gly-Ala (CHEBI:73899) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| glycylglycyl-L-alanine |
| Synonyms | Source |
|---|---|
| GGA | ChEBI |
| glycylglycylalanine | ChEBI |
| Gly-Gly-L-Ala | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728498 | Reaxys |
| CAS:19729-30-7 | ChemIDplus |
| CAS:19729-30-7 | NIST Chemistry WebBook |