EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13N3O4 |
| Net Charge | 0 |
| Average Mass | 203.198 |
| Monoisotopic Mass | 203.09061 |
| SMILES | NCC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C7H13N3O4/c8-3-6(12)10-4(7(13)14)1-2-5(9)11/h4H,1-3,8H2,(H2,9,11)(H,10,12)(H,13,14)/t4-/m0/s1 |
| InChIKey | PNMUAGGSDZXTHX-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Gln (CHEBI:73898) has role metabolite (CHEBI:25212) |
| Gly-Gln (CHEBI:73898) has role protective agent (CHEBI:50267) |
| Gly-Gln (CHEBI:73898) is a dipeptide (CHEBI:46761) |
| Gly-Gln (CHEBI:73898) is tautomer of Gly-Gln zwitterion (CHEBI:74392) |
| Incoming Relation(s) |
| Gly-Gln zwitterion (CHEBI:74392) is tautomer of Gly-Gln (CHEBI:73898) |
| IUPAC Name |
|---|
| glycyl-L-glutamine |
| Synonyms | Source |
|---|---|
| glycylglutamine | ChEBI |
| Glycyl-Glutamine | HMDB |
| Gly-L-Gln | ChEBI |
| GQ | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-13394 | MetaCyc |
| HMDB0028839 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2417369 | Reaxys |
| CAS:13115-71-4 | ChemIDplus |
| Citations |
|---|