EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H43NO3 |
| Net Charge | 0 |
| Average Mass | 369.590 |
| Monoisotopic Mass | 369.32429 |
| SMILES | CC(C)=CCC(O)C(C)CCC/C(C)=C/CCC(C)C[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C22H43NO3/c1-16(2)12-13-21(25)19(5)11-7-9-17(3)8-6-10-18(4)14-22(26)20(23)15-24/h8,12,18-22,24-26H,6-7,9-11,13-15,23H2,1-5H3/b17-8+/t18?,19?,20-,21?,22+/m0/s1 |
| InChIKey | ASNURABVVXFZSH-CGWCWHFRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aplidiasphingosine (CHEBI:73894) has role metabolite (CHEBI:25212) |
| aplidiasphingosine (CHEBI:73894) is a amino alcohol (CHEBI:22478) |
| aplidiasphingosine (CHEBI:73894) is a sphingoid (CHEBI:35785) |
| IUPAC Name |
|---|
| (2S,3R,8E)-2-amino-5,9,13,17-tetramethyloctadeca-8,16-diene-1,3,14-triol |
| Synonym | Source |
|---|---|
| 2S-amino-5,9,13,17-tetramethyl-8E,16-octadecadiene-1,3R,14-triol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMSP01080016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:68862-28-2 | ChemIDplus |