EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11N3O4 |
| Net Charge | 0 |
| Average Mass | 189.171 |
| Monoisotopic Mass | 189.07496 |
| SMILES | NCC(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C6H11N3O4/c7-2-5(11)9-3(6(12)13)1-4(8)10/h3H,1-2,7H2,(H2,8,10)(H,9,11)(H,12,13)/t3-/m0/s1 |
| InChIKey | FUESBOMYALLFNI-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Asn (CHEBI:73888) has role metabolite (CHEBI:25212) |
| Gly-Asn (CHEBI:73888) is a dipeptide (CHEBI:46761) |
| Gly-Asn (CHEBI:73888) is tautomer of Gly-Asn zwitterion (CHEBI:74391) |
| Incoming Relation(s) |
| Gly-Asn zwitterion (CHEBI:74391) is tautomer of Gly-Asn (CHEBI:73888) |
| IUPAC Name |
|---|
| glycyl-L-asparagine |
| Synonyms | Source |
|---|---|
| glycylasparagine | ChEBI |
| Gly-L-Asn | ChEBI |
| GN | ChEBI |
| Glycyl-Asparagine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028836 | HMDB |
| CPD-13395 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727380 | Reaxys |
| CAS:1999-33-3 | ChemIDplus |