EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O16P2 |
| Net Charge | -2 |
| Average Mass | 534.260 |
| Monoisotopic Mass | 534.02990 |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])O[C@H]3OC[C@](O)(CO)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C14H22N2O16P2/c17-4-14(23)5-28-12(10(14)21)31-34(26,27)32-33(24,25)29-3-6-8(19)9(20)11(30-6)16-2-1-7(18)15-13(16)22/h1-2,6,8-12,17,19-21,23H,3-5H2,(H,24,25)(H,26,27)(H,15,18,22)/p-2/t6-,8-,9-,10+,11-,12-,14-/m1/s1 |
| InChIKey | SYVORCSTSYHSPN-UXAZDEAISA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-α-D-apiose(2−) (CHEBI:73883) is a UDP-D-apiose(2−) (CHEBI:57572) |
| UDP-α-D-apiose(2−) (CHEBI:73883) is conjugate base of UDP-α-D-apiose (CHEBI:73886) |
| Incoming Relation(s) |
| UDP-α-D-apiose (CHEBI:73886) is conjugate acid of UDP-α-D-apiose(2−) (CHEBI:73883) |
| IUPAC Names |
|---|
| 5'-O-{[({[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]oxy}phosphinato)oxy]phosphinato}uridine |
| uridine 5'-{3-[3-C-(hydroxymethyl)-α-D-erythrofuranosyl] diphosphate} |
| UniProt Name | Source |
|---|---|
| UDP-α-D-apiose | UniProt |