EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H31NO |
| Net Charge | 0 |
| Average Mass | 229.408 |
| Monoisotopic Mass | 229.24056 |
| SMILES | CCCCCCCCCCC[C@@H](O)[C@H](C)N |
| InChI | InChI=1S/C14H31NO/c1-3-4-5-6-7-8-9-10-11-12-14(16)13(2)15/h13-14,16H,3-12,15H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | WMUMHAZHWIUBPN-UONOGXRCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-deoxytetradecasphinganine (CHEBI:73882) has functional parent tetradecasphinganine (CHEBI:71046) |
| 1-deoxytetradecasphinganine (CHEBI:73882) has role metabolite (CHEBI:25212) |
| 1-deoxytetradecasphinganine (CHEBI:73882) is a amino alcohol (CHEBI:22478) |
| 1-deoxytetradecasphinganine (CHEBI:73882) is a sphingoid (CHEBI:35785) |
| IUPAC Name |
|---|
| (2S,3R)-2-aminotetradecan-3-ol |
| Synonym | Source |
|---|---|
| Xestoaminol C | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMSP01080033 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8846324 | Reaxys |
| Citations |
|---|