EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H66FeN9O9 |
| Net Charge | 0 |
| Average Mass | 1113.087 |
| Monoisotopic Mass | 1112.43329 |
| SMILES | COC1=C(Cc2cnc3c(CC=C(C)C)cccc23)N2[O][Fe-3]34([O]N5C(=[O+]3)C(C)=NC(OC)=C5Cc3cnc5c(CC=C(C)C)cccc35)([O]N3C(=[O+]4)C(C)=NC(OC)=C3Cc3cnc4c(CC=C(C)C)cccc34)[O+]=C2C(C)=N1 |
| InChI | InChI=1S/3C20H22N3O3.Fe/c3*1-12(2)8-9-14-6-5-7-16-15(11-21-18(14)16)10-17-19(26-4)22-13(3)20(24)23(17)25;/h3*5-8,11,21H,9-10H2,1-4H3;/q3*-1;+3 |
| InChIKey | OEPBYEBLOCELCQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astechrome (CHEBI:73877) has role metabolite (CHEBI:25212) |
| astechrome (CHEBI:73877) is a indoles (CHEBI:24828) |
| astechrome (CHEBI:73877) is a iron(III) hydroxamate (CHEBI:28163) |
| astechrome (CHEBI:73877) is a pyrazines (CHEBI:38314) |
| Incoming Relation(s) |
| hexadehydroastechrome (CHEBI:73878) has functional parent astechrome (CHEBI:73877) |
| IUPAC Name |
|---|
| tris[1-(hydroxy-κO)-5-methoxy-3-methyl-6-{[7-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]methyl}pyrazin-2(1N)-onato-κO]iron |
| Synonyms | Source |
|---|---|
| iron(3+) tris[5-methoxy-3-methyl-6-{[7-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]methyl}-2-oxopyrazin-1(2H)-olate] | IUPAC |
| ferric tris[5-methoxy-3-methyl-6-{[7-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]methyl}-2-oxopyrazin-1(2H)-olate] | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23281931 | Reaxys |
| Citations |
|---|