EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N5O3 |
| Net Charge | 0 |
| Average Mass | 231.256 |
| Monoisotopic Mass | 231.13314 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C8H17N5O3/c9-4-6(14)13-5(7(15)16)2-1-3-12-8(10)11/h5H,1-4,9H2,(H,13,14)(H,15,16)(H4,10,11,12)/t5-/m0/s1 |
| InChIKey | JLXVRFDTDUGQEE-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Arg (CHEBI:73860) has role metabolite (CHEBI:25212) |
| Gly-Arg (CHEBI:73860) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| glycyl-L-arginine |
| Synonyms | Source |
|---|---|
| glycylarginine | ChEBI |
| Glycyl-Arginine | HMDB |
| Gly-L-Arg | ChEBI |
| GR | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028835 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728922 | Reaxys |