EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O3 |
| Net Charge | 0 |
| Average Mass | 146.146 |
| Monoisotopic Mass | 146.06914 |
| SMILES | C[C@H](NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C5H10N2O3/c1-3(5(9)10)7-4(8)2-6/h3H,2,6H2,1H3,(H,7,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | VPZXBVLAVMBEQI-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Ala (CHEBI:73855) has role metabolite (CHEBI:25212) |
| Gly-Ala (CHEBI:73855) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| glycyl-L-alanine |
| Synonyms | Source |
|---|---|
| GA | ChEBI |
| glycylalanine | ChEBI |
| Gly-L-Ala | ChEBI |
| N-Glycylalanine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724445 | Reaxys |
| CAS:3695-73-6 | ChemIDplus |