EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13N3O4 |
| Net Charge | 0 |
| Average Mass | 203.198 |
| Monoisotopic Mass | 203.09061 |
| SMILES | NC(=O)CC[C@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C7H13N3O4/c8-4(1-2-5(9)11)7(14)10-3-6(12)13/h4H,1-3,8H2,(H2,9,11)(H,10,14)(H,12,13)/t4-/m0/s1 |
| InChIKey | JEFZIKRIDLHOIF-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gln-Gly (CHEBI:73848) has role metabolite (CHEBI:25212) |
| Gln-Gly (CHEBI:73848) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-glutaminylglycine |
| Synonyms | Source |
|---|---|
| glutaminylglycine | ChEBI |
| Glutaminyl-Glycine | ChEBI |
| QG | ChEBI |
| L-Gln-Gly | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028797 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727353 | Reaxys |
| Citations |
|---|