EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N4O5 |
| Net Charge | 0 |
| Average Mass | 274.277 |
| Monoisotopic Mass | 274.12772 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H](N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H18N4O5/c11-5(1-3-7(12)15)9(17)14-6(10(18)19)2-4-8(13)16/h5-6H,1-4,11H2,(H2,12,15)(H2,13,16)(H,14,17)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | LOJYQMFIIJVETK-WDSKDSINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gln-Gln (CHEBI:73846) has functional parent L-glutamine (CHEBI:18050) |
| Gln-Gln (CHEBI:73846) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Gln-Gln (CHEBI:73846) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-glutaminyl-L-glutamine |
| Synonyms | Source |
|---|---|
| ChEBI | |
| L-Gln-L-Gln | ChEBI |
| glutaminylglutamine | ChEBI |
| Glutaminyl-Glutamine | HMDB |
| H-L-Gln-L-Gln-OH | ChEBI |
| H-Gln-Gln-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028795 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1716103 | Reaxys |