EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O5 |
| Net Charge | 0 |
| Average Mass | 204.182 |
| Monoisotopic Mass | 204.07462 |
| SMILES | N[C@@H](CCC(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H12N2O5/c8-4(7(13)14)1-2-5(10)9-3-6(11)12/h4H,1-3,8H2,(H,9,10)(H,11,12)(H,13,14)/t4-/m0/s1 |
| InChIKey | ACIJGUBIMXQCMF-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Gly (CHEBI:73845) has role human metabolite (CHEBI:77746) |
| γ-Glu-Gly (CHEBI:73845) is a glutamyl-L-amino acid (CHEBI:24323) |
| γ-Glu-Gly (CHEBI:73845) is conjugate acid of γ-Glu-Gly(1−) (CHEBI:133031) |
| Incoming Relation(s) |
| γ-Glu-Gly(1−) (CHEBI:133031) is conjugate base of γ-Glu-Gly (CHEBI:73845) |
| IUPAC Name |
|---|
| L-γ-glutamylglycine |
| Synonyms | Source |
|---|---|
| γ-L-Glu-Gly | ChEBI |
| L-γ-Glu-Gly | ChEBI |
| N-L-γ-glutamylglycine | ChemIDplus |
| 5-L-Glutamylglycine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011667 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728209 | Reaxys |
| CAS:1948-29-4 | ChemIDplus |
| Citations |
|---|