EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O3 |
| Net Charge | 0 |
| Average Mass | 146.146 |
| Monoisotopic Mass | 146.06914 |
| SMILES | C[C@@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H10N2O3/c1-3(6)5(10)7-2-4(8)9/h3H,2,6H2,1H3,(H,7,10)(H,8,9)/t3-/m1/s1 |
| InChIKey | CXISPYVYMQWFLE-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-Ala-Gly (CHEBI:73836) has role metabolite (CHEBI:25212) |
| D-Ala-Gly (CHEBI:73836) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| D-alanylglycine |
| Synonym | Source |
|---|---|
| aG | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723439 | Reaxys |