EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17N3O5 |
| Net Charge | 0 |
| Average Mass | 319.317 |
| Monoisotopic Mass | 319.11682 |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H17N3O5/c16-10(6-13(19)20)14(21)18-12(15(22)23)5-8-7-17-11-4-2-1-3-9(8)11/h1-4,7,10,12,17H,5-6,16H2,(H,18,21)(H,19,20)(H,22,23)/t10-,12-/m0/s1 |
| InChIKey | ZARXTZFGQZBYFO-JQWIXIFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Trp (CHEBI:73831) has role metabolite (CHEBI:25212) |
| Asp-Trp (CHEBI:73831) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| α-aspartyltryptophan | ChEBI |
| L-Asp-L-Trp | ChEBI |
| aspartyltryptophan | ChEBI |
| DW | ChEBI |
| L-α-Asp-L-Trp | ChEBI |
| Aspartyl-Tryptophan | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028764 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10474757 | Reaxys |