EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O7 |
| Net Charge | 0 |
| Average Mass | 262.218 |
| Monoisotopic Mass | 262.08010 |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14N2O7/c10-4(3-7(14)15)8(16)11-5(9(17)18)1-2-6(12)13/h4-5H,1-3,10H2,(H,11,16)(H,12,13)(H,14,15)(H,17,18)/t4-,5-/m0/s1 |
| InChIKey | CKAJHWFHHFSCDT-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Glu (CHEBI:73828) has role metabolite (CHEBI:25212) |
| Asp-Glu (CHEBI:73828) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| Aspartylglutamate | ChemIDplus |
| aspartylglutamic acid | ChEBI |
| DE | ChEBI |
| L-Asp-L-Glu | ChEBI |
| L-α-Asp-L-Glu | ChEBI |
| α-aspartylglutamic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1715776 | Reaxys |
| CAS:6157-06-8 | ChemIDplus |