EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O6 |
| Net Charge | 0 |
| Average Mass | 261.234 |
| Monoisotopic Mass | 261.09609 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H15N3O6/c10-4(3-7(14)15)8(16)12-5(9(17)18)1-2-6(11)13/h4-5H,1-3,10H2,(H2,11,13)(H,12,16)(H,14,15)(H,17,18)/t4-,5-/m0/s1 |
| InChIKey | GSMPSRPMQQDRIB-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Gln (CHEBI:73827) has role metabolite (CHEBI:25212) |
| Asp-Gln (CHEBI:73827) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-glutamine |
| Synonyms | Source |
|---|---|
| aspartylglutamine | ChEBI |
| Aspartyl-Glutamine | HMDB |
| DQ | ChEBI |
| L-Asp-L-Gln | ChEBI |
| L-α-Asp-L-Gln | ChEBI |
| α-aspartylglutamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028751 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11620644 | Reaxys |
| CAS:13433-13-1 | ChEBI |