EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O6 |
| Net Charge | 0 |
| Average Mass | 261.234 |
| Monoisotopic Mass | 261.09609 |
| SMILES | NC(=O)C[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H15N3O6/c10-4(3-6(11)13)8(16)12-5(9(17)18)1-2-7(14)15/h4-5H,1-3,10H2,(H2,11,13)(H,12,16)(H,14,15)(H,17,18)/t4-,5-/m0/s1 |
| InChIKey | IIFDPDVJAHQFSR-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Glu (CHEBI:73824) has role metabolite (CHEBI:25212) |
| Asn-Glu (CHEBI:73824) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-asparaginyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| asparaginylglutamic acid | ChEBI |
| L-Asn-L-Glu | ChEBI |
| NE | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2753824 | Reaxys |