EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N5O4 |
| Net Charge | 0 |
| Average Mass | 337.380 |
| Monoisotopic Mass | 337.17500 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C15H23N5O4/c16-11(2-1-7-19-15(17)18)13(22)20-12(14(23)24)8-9-3-5-10(21)6-4-9/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19)/t11-,12-/m0/s1 |
| InChIKey | XTWSWDJMIKUJDQ-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Tyr (CHEBI:73822) has role metabolite (CHEBI:25212) |
| Arg-Tyr (CHEBI:73822) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-arginyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| arginyltyrosine | ChEBI |
| Arginyl-Tyrosine | HMDB |
| RY | ChEBI |
| L-Arg-L-Tyr | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028721 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3170774 | Reaxys |