EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N5O4 |
| Net Charge | 0 |
| Average Mass | 261.282 |
| Monoisotopic Mass | 261.14370 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C9H19N5O4/c10-5(2-1-3-13-9(11)12)7(16)14-6(4-15)8(17)18/h5-6,15H,1-4,10H2,(H,14,16)(H,17,18)(H4,11,12,13)/t5-,6-/m0/s1 |
| InChIKey | IJYZHIOOBGIINM-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Ser (CHEBI:73819) has role metabolite (CHEBI:25212) |
| Arg-Ser (CHEBI:73819) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-arginyl-L-serine |
| Synonyms | Source |
|---|---|
| arginylserine | ChEBI |
| Arginyl-Serine | HMDB |
| RS | ChEBI |
| L-Arg-L-Ser | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028718 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5065168 | Reaxys |