EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23N5O3S |
| Net Charge | 0 |
| Average Mass | 305.404 |
| Monoisotopic Mass | 305.15216 |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C11H23N5O3S/c1-20-6-4-8(10(18)19)16-9(17)7(12)3-2-5-15-11(13)14/h7-8H,2-6,12H2,1H3,(H,16,17)(H,18,19)(H4,13,14,15)/t7-,8-/m0/s1 |
| InChIKey | ROWCTNFEMKOIFQ-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Met (CHEBI:73817) has role metabolite (CHEBI:25212) |
| Arg-Met (CHEBI:73817) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-arginyl-L-methionine |
| Synonyms | Source |
|---|---|
| arginylmethionine | ChEBI |
| Arginyl-Methionine | HMDB |
| RM | ChEBI |
| L-Arg-L-Met | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028715 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4261900 | Reaxys |