EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26N6O3 |
| Net Charge | 0 |
| Average Mass | 302.379 |
| Monoisotopic Mass | 302.20664 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C12H26N6O3/c13-6-2-1-5-9(11(20)21)18-10(19)8(14)4-3-7-17-12(15)16/h8-9H,1-7,13-14H2,(H,18,19)(H,20,21)(H4,15,16,17)/t8-,9-/m0/s1 |
| InChIKey | JQFZHHSQMKZLRU-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Lys (CHEBI:73816) has role metabolite (CHEBI:25212) |
| Arg-Lys (CHEBI:73816) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-arginyl-L-lysine |
| Synonyms | Source |
|---|---|
| L-Arg-L-Lys | ChEBI |
| arginyllysine | ChEBI |
| RK | ChEBI |
| Arginyl-Lysine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028714 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2391715 | Reaxys |