EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H25N5O3 |
| Net Charge | 0 |
| Average Mass | 287.364 |
| Monoisotopic Mass | 287.19574 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C12H25N5O3/c1-3-7(2)9(11(19)20)17-10(18)8(13)5-4-6-16-12(14)15/h7-9H,3-6,13H2,1-2H3,(H,17,18)(H,19,20)(H4,14,15,16)/t7-,8-,9-/m0/s1 |
| InChIKey | QYLJIYOGHRGUIH-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Ile (CHEBI:73814) has role metabolite (CHEBI:25212) |
| Arg-Ile (CHEBI:73814) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-arginyl-L-isoleucine |
| Synonyms | Source |
|---|---|
| arginylisoleucine | ChEBI |
| Arginyl-Isoleucine | ChEBI |
| RI | ChEBI |
| L-Arg-L-Ile | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028712 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1715537 | Reaxys |