EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22N6O4 |
| Net Charge | 0 |
| Average Mass | 302.335 |
| Monoisotopic Mass | 302.17025 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H22N6O4/c12-6(2-1-5-16-11(14)15)9(19)17-7(10(20)21)3-4-8(13)18/h6-7H,1-5,12H2,(H2,13,18)(H,17,19)(H,20,21)(H4,14,15,16)/t6-,7-/m0/s1 |
| InChIKey | PMGDADKJMCOXHX-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Gln (CHEBI:73813) has role metabolite (CHEBI:25212) |
| Arg-Gln (CHEBI:73813) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-arginyl-L-glutamine |
| Synonyms | Source |
|---|---|
| arginylglutamine | ChEBI |
| L-Arg-L-Gln | ChEBI |
| RQ | ChEBI |
| Arginyl-Glutamine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028707 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1716638 | Reaxys |