EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N5O5 |
| Net Charge | 0 |
| Average Mass | 289.292 |
| Monoisotopic Mass | 289.13862 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H19N5O5/c11-5(2-1-3-14-10(12)13)8(18)15-6(9(19)20)4-7(16)17/h5-6H,1-4,11H2,(H,15,18)(H,16,17)(H,19,20)(H4,12,13,14)/t5-,6-/m0/s1 |
| InChIKey | SIFXMYAHXJGAFC-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Asp (CHEBI:73812) has role metabolite (CHEBI:25212) |
| Arg-Asp (CHEBI:73812) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-arginyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| arginylaspartic acid | ChEBI |
| RD | ChEBI |
| L-Arg-L-Asp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028705 | HMDB |