EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26N8O3 |
| Net Charge | 0 |
| Average Mass | 330.393 |
| Monoisotopic Mass | 330.21279 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C12H26N8O3/c13-7(3-1-5-18-11(14)15)9(21)20-8(10(22)23)4-2-6-19-12(16)17/h7-8H,1-6,13H2,(H,20,21)(H,22,23)(H4,14,15,18)(H4,16,17,19)/t7-,8-/m0/s1 |
| InChIKey | OMLWNBVRVJYMBQ-YUMQZZPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Arg (CHEBI:73811) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Arg-Arg (CHEBI:73811) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-arginyl-L-arginine |
| Synonyms | Source |
|---|---|
| arginylarginine | ChEBI |
| RR | ChEBI |
| L-Arg-L-Arg | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028703 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1730089 | Reaxys |
| CAS:15483-27-9 | ChemIDplus |