EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N3O3 |
| Net Charge | 0 |
| Average Mass | 275.308 |
| Monoisotopic Mass | 275.12699 |
| SMILES | C[C@H](N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H17N3O3/c1-8(15)13(18)17-12(14(19)20)6-9-7-16-11-5-3-2-4-10(9)11/h2-5,7-8,12,16H,6,15H2,1H3,(H,17,18)(H,19,20)/t8-,12-/m0/s1 |
| InChIKey | WUGMRIBZSVSJNP-UFBFGSQYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Trp (CHEBI:73808) has role metabolite (CHEBI:25212) |
| Ala-Trp (CHEBI:73808) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-alanyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| alanyltryptophan | ChEBI |
| AW | ChEBI |
| N-L-Alanyl-L-tryptophan | ChemIDplus |
| L-Ala-L-Trp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028698 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4910138 | Reaxys |
| CAS:16305-75-2 | ChemIDplus |