EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N2O3 |
| Net Charge | 0 |
| Average Mass | 236.271 |
| Monoisotopic Mass | 236.11609 |
| SMILES | C[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H16N2O3/c1-8(13)11(15)14-10(12(16)17)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
| InChIKey | OMNVYXHOSHNURL-WPRPVWTQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Phe (CHEBI:73807) has role metabolite (CHEBI:25212) |
| Ala-Phe (CHEBI:73807) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-alanyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| AF | ChEBI |
| alanylphenylalanine | ChEBI |
| L-Ala-L-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028694 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2381598 | Reaxys |
| CAS:3061-90-3 | ChemIDplus |