EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O3 |
| Net Charge | 0 |
| Average Mass | 202.254 |
| Monoisotopic Mass | 202.13174 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](C)N)C(=O)O |
| InChI | InChI=1S/C9H18N2O3/c1-4-5(2)7(9(13)14)11-8(12)6(3)10/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14)/t5-,6-,7-/m0/s1 |
| InChIKey | ZSOICJZJSRWNHX-ACZMJKKPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Ile (CHEBI:73805) has role metabolite (CHEBI:25212) |
| Ala-Ile (CHEBI:73805) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-alanyl-L-isoleucine |
| Synonyms | Source |
|---|---|
| alanylisoleucine | ChEBI |
| AI | ChEBI |
| L-Ala-L-Ile | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028690 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3606306 | Reaxys |