EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O5 |
| Net Charge | 0 |
| Average Mass | 190.155 |
| Monoisotopic Mass | 190.05897 |
| SMILES | NCC(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10N2O5/c7-2-4(9)8-3(6(12)13)1-5(10)11/h3H,1-2,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m0/s1 |
| InChIKey | SCCPDJAQCXWPTF-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Asp (CHEBI:73804) has role metabolite (CHEBI:25212) |
| Gly-Asp (CHEBI:73804) is a dipeptide (CHEBI:46761) |
| Gly-Asp (CHEBI:73804) is conjugate acid of Gly-Asp(1−) (CHEBI:191204) |
| Incoming Relation(s) |
| Gly-Asp(1−) (CHEBI:191204) is conjugate base of Gly-Asp (CHEBI:73804) |
| IUPAC Name |
|---|
| glycyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| G-D | ChEBI |
| GD | ChEBI |
| glycylaspartic acid | ChEBI |
| Gly-L-Asp | ChEBI |
| N-Glycyl-L-aspartic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028837 | HMDB |
| Citations |
|---|