EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O5 |
| Net Charge | 0 |
| Average Mass | 204.182 |
| Monoisotopic Mass | 204.07462 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H12N2O5/c1-3(8)6(12)9-4(7(13)14)2-5(10)11/h3-4H,2,8H2,1H3,(H,9,12)(H,10,11)(H,13,14)/t3-,4-/m0/s1 |
| InChIKey | XAEWTDMGFGHWFK-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Asp (CHEBI:73803) has role metabolite (CHEBI:25212) |
| Ala-Asp (CHEBI:73803) is a dipeptide (CHEBI:46761) |
| Ala-Asp (CHEBI:73803) is conjugate acid of Ala-Asp(1−) (CHEBI:74363) |
| Incoming Relation(s) |
| Ala-Asp(1−) (CHEBI:74363) is conjugate base of Ala-Asp (CHEBI:73803) |
| IUPAC Name |
|---|
| L-alanyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| AD | ChEBI |
| alanylaspartic acid | ChEBI |
| L-Ala-L-Asp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-13404 | MetaCyc |
| HMDB0028683 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4745285 | Reaxys |
| CAS:20727-65-5 | ChemIDplus |