EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73801 - Gly-Glu
| Formula | C7H12N2O5 |
| Net Charge | 0 |
| Average Mass | 204.182 |
| Monoisotopic Mass | 204.07462 |
| SMILES | NCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H12N2O5/c8-3-5(10)9-4(7(13)14)1-2-6(11)12/h4H,1-3,8H2,(H,9,10)(H,11,12)(H,13,14)/t4-/m0/s1 |
| InChIKey | IEFJWDNGDZAYNZ-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Glu (CHEBI:73801) has role metabolite (CHEBI:25212) |
| Gly-Glu (CHEBI:73801) is a dipeptide (CHEBI:46761) |
| Gly-Glu (CHEBI:73801) is conjugate acid of Gly-Glu(1−) (CHEBI:73784) |
| Incoming Relation(s) |
| Gly-Glu(1−) (CHEBI:73784) is conjugate base of Gly-Glu (CHEBI:73801) |
| IUPAC Name |
|---|
| glycyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| GE | ChEBI |
| Gly-L-Glu | ChEBI |
| N-Glycylglutamic acid | ChemIDplus |
| N-Glycyl-L-glutamic acid | ChemIDplus |