EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H30O8 |
| Net Charge | 0 |
| Average Mass | 530.573 |
| Monoisotopic Mass | 530.19407 |
| SMILES | CC(C)=CCc1c2c(cc3c1O[C@H](c1c(O)c(O)cc(-c4ccc(O)cc4O)c1O)CC3=O)C=CC(C)(C)O2 |
| InChI | InChI=1S/C31H30O8/c1-15(2)5-7-19-29-16(9-10-31(3,4)39-29)11-21-23(34)14-25(38-30(19)21)26-27(36)20(13-24(35)28(26)37)18-8-6-17(32)12-22(18)33/h5-6,8-13,25,32-33,35-37H,7,14H2,1-4H3/t25-/m0/s1 |
| InChIKey | XFFLLCTVQRLAND-VWLOTQADSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eriosemaone C (CHEBI:73778) has role metabolite (CHEBI:25212) |
| eriosemaone C (CHEBI:73778) is a extended flavonoid (CHEBI:71037) |
| eriosemaone C (CHEBI:73778) is a pyranochromane (CHEBI:74632) |
| eriosemaone C (CHEBI:73778) is a resorcinols (CHEBI:33572) |
| eriosemaone C (CHEBI:73778) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (8S)-2,2-dimethyl-10-(3-methylbut-2-en-1-yl)-8-(2,2',4,4',5-pentahydroxybiphenyl-3-yl)-7,8-dihydro-2H,6H-pyrano[3,2-g]chromen-6-one |
| Synonym | Source |
|---|---|
| (S)-2',3',6'-Trihydroxy-8-prenyl-5'-(2,4-dihydroxyphenyl)-6'',6''-dimethylpyrano[2'',3'':7,6]flavanone | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140004 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7325384 | Reaxys |