EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O5 |
| Net Charge | 0 |
| Average Mass | 388.504 |
| Monoisotopic Mass | 388.22497 |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H32O5/c24-18(13-12-17-8-4-3-5-9-17)14-15-20-19(21(25)16-22(20)26)10-6-1-2-7-11-23(27)28/h1,3-6,8-9,14-15,18-22,24-26H,2,7,10-13,16H2,(H,27,28)/b6-1-,15-14+/t18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | YFHHIZGZVLHBQZ-KDACTHKWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-phenyl-trinor-prostaglandin F2α (CHEBI:73773) has functional parent latanoprost free acid (CHEBI:63925) |
| 17-phenyl-trinor-prostaglandin F2α (CHEBI:73773) has role metabolite (CHEBI:25212) |
| 17-phenyl-trinor-prostaglandin F2α (CHEBI:73773) is a prostaglandins Fα (CHEBI:36066) |
| IUPAC Name |
|---|
| (5Z)-7-{(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxy-5-phenylpent-1-en-1-yl]cyclopentyl}hept-5-enoic acid |
| Synonyms | Source |
|---|---|
| 17-phenyl-trinor-PGF2α | LIPID MAPS |
| 9S,11R,15S-trihydroxy-17-phenyl-18,19,20-trinor-5Z,13E-prostadienoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010081 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5771877 | Reaxys |
| CAS:38344-08-0 | ChemIDplus |