EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O3 |
| Net Charge | 0 |
| Average Mass | 226.236 |
| Monoisotopic Mass | 226.10659 |
| SMILES | C[C@H](N)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C9H14N4O3/c1-5(10)8(14)13-7(9(15)16)2-6-3-11-4-12-6/h3-5,7H,2,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t5-,7-/m0/s1 |
| InChIKey | XZWXFWBHYRFLEF-FSPLSTOPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-His (CHEBI:73771) has role metabolite (CHEBI:25212) |
| Ala-His (CHEBI:73771) is a dipeptide (CHEBI:46761) |
| Ala-His (CHEBI:73771) is tautomer of Ala-His zwitterion (CHEBI:74388) |
| Incoming Relation(s) |
| Ala-His zwitterion (CHEBI:74388) is tautomer of Ala-His (CHEBI:73771) |
| IUPAC Name |
|---|
| L-alanyl-L-histidine |
| Synonyms | Source |
|---|---|
| AH | ChEBI |
| alanylhistidine | ChEBI |
| Alanyl-Histidine | HMDB |
| N-L-Alanyl-L-histidine | ChemIDplus |
| L-Ala-L-His | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-13401 | MetaCyc |
| HMDB0028689 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5557090 | Reaxys |
| CAS:3253-17-6 | ChemIDplus |