EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N4O4 |
| Net Charge | 0 |
| Average Mass | 298.343 |
| Monoisotopic Mass | 298.16411 |
| SMILES | C[N+](C)(C)C(CCc1ncc(C[C@H](N)C(=O)O)n1)C(=O)[O-] |
| InChI | InChI=1S/C13H22N4O4/c1-17(2,3)10(13(20)21)4-5-11-15-7-8(16-11)6-9(14)12(18)19/h7,9-10H,4-6,14H2,1-3H3,(H2-,15,16,18,19,20,21)/t9-,10?/m0/s1 |
| InChIKey | CBQVLMCHMFGPMX-RGURZIINSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[3-carboxylato-3-(trimethylammonio)propyl]-L-histidine (CHEBI:73766) is a L-histidine derivative (CHEBI:84076) |
| 2-[3-carboxylato-3-(trimethylammonio)propyl]-L-histidine (CHEBI:73766) is a amino-acid betaine (CHEBI:22860) |
| 2-[3-carboxylato-3-(trimethylammonio)propyl]-L-histidine (CHEBI:73766) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| 2-[3-carboxylato-3-(trimethylammonio)propyl]-L-histidine residue (CHEBI:73746) is substituent group from 2-[3-carboxylato-3-(trimethylammonio)propyl]-L-histidine (CHEBI:73766) |
| IUPAC Name |
|---|
| 4-{5-[(2S)-2-amino-2-carboxyethyl]-1H-imidazol-2-yl}-2-(trimethylazaniumyl)butanoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059617 | HMDB |