EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O4 |
| Net Charge | 0 |
| Average Mass | 284.316 |
| Monoisotopic Mass | 284.14846 |
| SMILES | CN(C)C(CCc1ncc(C[C@H](N)C(=O)O)n1)C(=O)O |
| InChI | InChI=1S/C12H20N4O4/c1-16(2)9(12(19)20)3-4-10-14-6-7(15-10)5-8(13)11(17)18/h6,8-9H,3-5,13H2,1-2H3,(H,14,15)(H,17,18)(H,19,20)/t8-,9?/m0/s1 |
| InChIKey | GFBGZDGVFNNXRE-IENPIDJESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[3-carboxy-3-(dimethylamino)propyl]-L-histidine (CHEBI:73764) is a L-histidine derivative (CHEBI:84076) |
| 2-[3-carboxy-3-(dimethylamino)propyl]-L-histidine (CHEBI:73764) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 2-[3-carboxy-3-(dimethylamino)propyl]-L-histidine (CHEBI:73764) is tautomer of 2-[3-carboxylato-3-(dimethylammonio)propyl]-L-histidine dizwitterion (CHEBI:73763) |
| Incoming Relation(s) |
| 2-[3-carboxylato-3-(dimethylammonio)propyl]-L-histidine dizwitterion (CHEBI:73763) is tautomer of 2-[3-carboxy-3-(dimethylamino)propyl]-L-histidine (CHEBI:73764) |
| IUPAC Name |
|---|
| 2-[3-carboxy-3-(dimethylamino)propyl]-L-histidine |