EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O3 |
| Net Charge | 0 |
| Average Mass | 146.186 |
| Monoisotopic Mass | 146.09429 |
| SMILES | CCCCCC(O)C(=O)O |
| InChI | InChI=1S/C7H14O3/c1-2-3-4-5-6(8)7(9)10/h6,8H,2-5H2,1H3,(H,9,10) |
| InChIKey | RGMMREBHCYXQMA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyheptanoic acid (CHEBI:73752) has functional parent heptanoic acid (CHEBI:45571) |
| 2-hydroxyheptanoic acid (CHEBI:73752) has role metabolite (CHEBI:25212) |
| 2-hydroxyheptanoic acid (CHEBI:73752) is a 2-hydroxy fatty acid (CHEBI:10283) |
| IUPAC Name |
|---|
| 2-hydroxyheptanoic acid |
| Synonym | Source |
|---|---|
| 2-hydroxy enanthoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722019 | Reaxys |
| CAS:636-69-1 | ChemIDplus |
| Citations |
|---|