EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19NO2 |
| Net Charge | 0 |
| Average Mass | 173.256 |
| Monoisotopic Mass | 173.14158 |
| SMILES | NCCCCCCCCC(=O)O |
| InChI | InChI=1S/C9H19NO2/c10-8-6-4-2-1-3-5-7-9(11)12/h1-8,10H2,(H,11,12) |
| InChIKey | VWPQCOZMXULHDM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-aminononanoic acid (CHEBI:73740) has functional parent nonanoic acid (CHEBI:29019) |
| 9-aminononanoic acid (CHEBI:73740) has role metabolite (CHEBI:25212) |
| 9-aminononanoic acid (CHEBI:73740) is a ω-amino fatty acid (CHEBI:59758) |
| IUPAC Name |
|---|
| 9-aminononanoic acid |
| Manual Xrefs | Databases |
|---|---|
| EP2307353 | Patent |
| LMFA01100010 | LIPID MAPS |
| US2011105774 | Patent |
| WO2010004220 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1759466 | Reaxys |
| CAS:1120-12-3 | ChemIDplus |
| Citations |
|---|