EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO2 |
| Net Charge | 0 |
| Average Mass | 159.229 |
| Monoisotopic Mass | 159.12593 |
| SMILES | CCCCCC(N)CC(=O)O |
| InChI | InChI=1S/C8H17NO2/c1-2-3-4-5-7(9)6-8(10)11/h7H,2-6,9H2,1H3,(H,10,11) |
| InChIKey | FYHHDJRMDOBZJF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-aminooctanoic acid (CHEBI:73739) has functional parent octanoic acid (CHEBI:28837) |
| 3-aminooctanoic acid (CHEBI:73739) has role metabolite (CHEBI:25212) |
| 3-aminooctanoic acid (CHEBI:73739) is a β-amino acid (CHEBI:33706) |
| 3-aminooctanoic acid (CHEBI:73739) is a β-amino-fatty acid (CHEBI:59754) |
| IUPAC Name |
|---|
| 3-aminooctanoic acid |
| Synonyms | Source |
|---|---|
| 3-aminocaprylic acid | ChEBI |
| β-aminocaprylic acid | ChEBI |
| β-aminooctanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01100020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1760758 | Reaxys |
| Citations |
|---|