EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H44O2 |
| Net Charge | 0 |
| Average Mass | 352.603 |
| Monoisotopic Mass | 352.33413 |
| SMILES | C=CCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C23H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h2H,1,3-22H2,(H,24,25) |
| InChIKey | YGTSVJQQDISEHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22-tricosenoic acid (CHEBI:73736) has parent hydride tricosanoic acid (CHEBI:42394) |
| 22-tricosenoic acid (CHEBI:73736) has role metabolite (CHEBI:25212) |
| 22-tricosenoic acid (CHEBI:73736) is a tricosenoic acid (CHEBI:73734) |
| Synonym | Source |
|---|---|
| tricos-22-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030091 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1796711 | Reaxys |
| Citations |
|---|