EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H41NO2 |
| Net Charge | 0 |
| Average Mass | 351.575 |
| Monoisotopic Mass | 351.31373 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C22H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,24H,2-5,8,11-21H2,1H3,(H,23,25)/b7-6-,10-9- |
| InChIKey | MWQCBVWCBTUPDQ-HZJYTTRNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(11Z,14Z)-eicosadienoylethanolamine (CHEBI:73733) has functional parent (11Z,14Z)-icosadienoic acid (CHEBI:73731) |
| N-(11Z,14Z)-eicosadienoylethanolamine (CHEBI:73733) has role metabolite (CHEBI:25212) |
| N-(11Z,14Z)-eicosadienoylethanolamine (CHEBI:73733) is a N-(polyunsaturated fatty acyl)ethanolamine (CHEBI:85281) |
| N-(11Z,14Z)-eicosadienoylethanolamine (CHEBI:73733) is a N-acylethanolamine (CHEBI:52640) |
| N-(11Z,14Z)-eicosadienoylethanolamine (CHEBI:73733) is a fatty amide (CHEBI:29348) |
| IUPAC Name |
|---|
| (11Z,14Z)-N-(2-hydroxyethyl)icosa-11,14-dienamide |
| Synonym | Source |
|---|---|
| N-cis-11,14-eicosadienoyl ethanolamine | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA08040002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7642643 | Reaxys |