EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O4 |
| Net Charge | 0 |
| Average Mass | 342.520 |
| Monoisotopic Mass | 342.27701 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O4/c21-19(22)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(23)24/h1-18H2,(H,21,22)(H,23,24) |
| InChIKey | JJOJFIHJIRWASH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icosanedioic acid (CHEBI:73728) has parent hydride icosane (CHEBI:43619) |
| icosanedioic acid (CHEBI:73728) has role metabolite (CHEBI:25212) |
| icosanedioic acid (CHEBI:73728) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| icosanedioic acid (CHEBI:73728) is conjugate acid of icosanedioic acid anion (CHEBI:133143) |
| Incoming Relation(s) |
| icosanedioic acid anion (CHEBI:133143) is conjugate base of icosanedioic acid (CHEBI:73728) |
| IUPAC Name |
|---|
| icosanedioic acid |
| Synonyms | Source |
|---|---|
| eicosa-1,20-dioic acid | ChEBI |
| 1,20-icosanedioic acid | ChEBI |
| octadecane-1,18-dicarboxylic acid | ChEBI |
| 1,18-octadecanedicarboxylic acid | ChEBI |
| eicosanedioic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01170035 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1799665 | Reaxys |
| CAS:2424-92-2 | ChemIDplus |
| Citations |
|---|