EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H37NO3 |
| Net Charge | 0 |
| Average Mass | 339.520 |
| Monoisotopic Mass | 339.27734 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C20H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(23)24/h9-10H,2-8,11-18H2,1H3,(H,21,22)(H,23,24)/b10-9- |
| InChIKey | HPFXACZRFJDURI-KTKRTIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (21359215) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoylglycine (CHEBI:73723) has functional parent oleic acid (CHEBI:16196) |
| N-oleoylglycine (CHEBI:73723) has role metabolite (CHEBI:25212) |
| N-oleoylglycine (CHEBI:73723) is a N-acylglycine 18:1 (CHEBI:134152) |
| N-oleoylglycine (CHEBI:73723) is a fatty amide (CHEBI:29348) |
| N-oleoylglycine (CHEBI:73723) is conjugate acid of N-oleoylglycinate (CHEBI:133992) |
| Incoming Relation(s) |
| N-oleoylglycinate (CHEBI:133992) is conjugate base of N-oleoylglycine (CHEBI:73723) |
| IUPAC Names |
|---|
| [(9Z)-octadec-9-enoylamino]acetic acid |
| N-[(9Z)-octadec-9-enoyl]glycine |
| Synonyms | Source |
|---|---|
| Elmiric acid | LIPID MAPS |
| EMA-1 | LIPID MAPS |
| N-(9Z-octadecenoyl)-glycine | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013631 | HMDB |
| LMFA08020082 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2219189 | Reaxys |
| CAS:2601-90-3 | ChemIDplus |
| Citations |
|---|