EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24O4 |
| Net Charge | 0 |
| Average Mass | 244.331 |
| Monoisotopic Mass | 244.16746 |
| SMILES | O=C(O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C13H24O4/c14-12(15)10-8-6-4-2-1-3-5-7-9-11-13(16)17/h1-11H2,(H,14,15)(H,16,17) |
| InChIKey | DXNCZXXFRKPEPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridecanedioic acid (CHEBI:73718) has role metabolite (CHEBI:25212) |
| tridecanedioic acid (CHEBI:73718) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| IUPAC Name |
|---|
| tridecanedioic acid |
| Synonyms | Source |
|---|---|
| 1,11-Undecanedicarboxylic acid | HMDB |
| 1,13-Tridecanedioic acid | HMDB |
| Brassilic acid | HMDB |
| Brassylic acid | HMDB |
| Undecane-1,11-dicarboxylic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002327 | HMDB |
| LMFA01170014 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1786404 | Reaxys |
| CAS:505-52-2 | ChemIDplus |
| Citations |
|---|