EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O4 |
| Net Charge | 0 |
| Average Mass | 216.277 |
| Monoisotopic Mass | 216.13616 |
| SMILES | O=C(O)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C11H20O4/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15/h1-9H2,(H,12,13)(H,14,15) |
| InChIKey | LWBHHRRTOZQPDM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| undecanedioic acid (CHEBI:73713) has role metabolite (CHEBI:25212) |
| undecanedioic acid (CHEBI:73713) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| undecanedioic acid (CHEBI:73713) is conjugate acid of undecanedioic acid anion (CHEBI:133628) |
| Incoming Relation(s) |
| undecanedioic acid anion (CHEBI:133628) is conjugate base of undecanedioic acid (CHEBI:73713) |
| IUPAC Name |
|---|
| undecanedioic acid |
| Synonyms | Source |
|---|---|
| 1,11-Undecanedioic acid | HMDB |
| Hendecanedioic acid | HMDB |
| Undecanedionic acid | HMDB |
| 1,9-Nonanedicarboxylic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000888 | HMDB |
| LMFA01170007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1780537 | Reaxys |
| CAS:1852-04-6 | ChemIDplus |
| Citations |
|---|